C14H12Cl2N2O — CID 112752525
4,6-dichloro-2-(4-propan-2-ylphenyl)pyrimidine-5-carbaldehyde (PubChem CID 112752525) has the molecular formula C14H12Cl2N2O and a molecular weight of 295.17 g/mol. Its IUPAC name is 4,6-dichloro-2-(4-propan-2-ylphenyl)pyrimidine-5-carbaldehyde.
| Compound Name | 4,6-dichloro-2-(4-propan-2-ylphenyl)pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 112752525 |
| Molecular Formula | C14H12Cl2N2O |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 4,6-dichloro-2-(4-propan-2-ylphenyl)pyrimidine-5-carbaldehyde |
| SMILES | CC(C)c1ccc(-c2nc(Cl)c(C=O)c(Cl)n2)cc1 |
| InChI | InChI=1S/C14H12Cl2N2O/c1-8(2)9-3-5-10(6-4-9)14-17-12(15)11(7-19)13(16)18-14/h3-8H,1-2H3 |
| InChIKey | MSNPOTQQRCXPAM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|