C13H14N2O3 — CID 82130636
N-(1,3-benzodioxol-5-yl)-1-(furan-2-yl)ethane-1,2-diamine (PubChem CID 82130636) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-1-(furan-2-yl)ethane-1,2-diamine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-1-(furan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 82130636 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-1-(furan-2-yl)ethane-1,2-diamine |
| SMILES | NCC(Nc1ccc2c(c1)OCO2)c1ccco1 |
| InChI | InChI=1S/C13H14N2O3/c14-7-10(11-2-1-5-16-11)15-9-3-4-12-13(6-9)18-8-17-12/h1-6,10,15H,7-8,14H2 |
| InChIKey | HASDGNIFXPKKPY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 69.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|