4-formyl-1-(2,4,6-trimethylphenyl)pyrazole-3-carboxylic acid

C14H14N2O3 — CID 82132480

IUPAC4-formyl-1-(2,4,6-trimethylphenyl)pyrazole-3-carboxylic acid
SMILESCc1cc(C)c(-n2cc(C=O)c(C(=O)O)n2)c(C)c1
InChIInChI=1S/C14H14N2O3/c1-8-4-9(2)13(10(3)5-8)16-6-11(7-17)12(15-16)14(18)19/h4-7H,1-3H3,(H,18,19)
InChIKeyWYVLQPVFQCRWDI-UHFFFAOYSA-N
MW258.28 g/mol
LogP2.31
Rot. Bonds3

About 4-formyl-1-(2,4,6-trimethylphenyl)pyrazole-3-carboxylic acid

4-formyl-1-(2,4,6-trimethylphenyl)pyrazole-3-carboxylic acid (PubChem CID 82132480) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 4-formyl-1-(2,4,6-trimethylphenyl)pyrazole-3-carboxylic acid.

Molecular Properties

Compound Name4-formyl-1-(2,4,6-trimethylphenyl)pyrazole-3-carboxylic acid
PubChem CID82132480
Molecular FormulaC14H14N2O3
Molecular Weight258.28 g/mol
Exact Mass258.10
IUPAC Name4-formyl-1-(2,4,6-trimethylphenyl)pyrazole-3-carboxylic acid
SMILESCc1cc(C)c(-n2cc(C=O)c(C(=O)O)n2)c(C)c1
InChIInChI=1S/C14H14N2O3/c1-8-4-9(2)13(10(3)5-8)16-6-11(7-17)12(15-16)14(18)19/h4-7H,1-3H3,(H,18,19)
InChIKeyWYVLQPVFQCRWDI-UHFFFAOYSA-N
XLogP2.31
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.28
LogP ≤ 52.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 4-formyl-1-(2,4,6-trimethylphenyl)pyrazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-formyl-1-(2,4,6-trimethylphenyl)pyrazole-3-carboxylic acid?
The IUPAC name of 4-formyl-1-(2,4,6-trimethylphenyl)pyrazole-3-carboxylic acid (CID 82132480) is 4-formyl-1-(2,4,6-trimethylphenyl)pyrazole-3-carboxylic acid.
What is the SMILES notation for 4-formyl-1-(2,4,6-trimethylphenyl)pyrazole-3-carboxylic acid?
The canonical SMILES for 4-formyl-1-(2,4,6-trimethylphenyl)pyrazole-3-carboxylic acid is Cc1cc(C)c(-n2cc(C=O)c(C(=O)O)n2)c(C)c1.
What is the InChIKey of 4-formyl-1-(2,4,6-trimethylphenyl)pyrazole-3-carboxylic acid?
The InChIKey is WYVLQPVFQCRWDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O3/c1-8-4-9(2)13(10(3)5-8)16-6-11(7-17)12(15-16)14(18)19/h4-7H,1-3H3,(H,18,19).
What are the key properties of 4-formyl-1-(2,4,6-trimethylphenyl)pyrazole-3-carboxylic acid?
4-formyl-1-(2,4,6-trimethylphenyl)pyrazole-3-carboxylic acid has a molecular weight of 258.28 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-formyl-1-(2,4,6-trimethylphenyl)pyrazole-3-carboxylic acid is sourced from PubChem (CID 82132480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).