C12H11NO3 — CID 83946997
3-formyl-1,5-dimethylindole-6-carboxylic acid (PubChem CID 83946997) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is 3-formyl-1,5-dimethylindole-6-carboxylic acid.
| Compound Name | 3-formyl-1,5-dimethylindole-6-carboxylic acid |
|---|---|
| PubChem CID | 83946997 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 3-formyl-1,5-dimethylindole-6-carboxylic acid |
| SMILES | Cc1cc2c(C=O)cn(C)c2cc1C(=O)O |
| InChI | InChI=1S/C12H11NO3/c1-7-3-10-8(6-14)5-13(2)11(10)4-9(7)12(15)16/h3-6H,1-2H3,(H,15,16) |
| InChIKey | POVBACVGYMOPRC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|