C18H18FNO — CID 82137559
4-(2,4-dimethylphenoxy)-2-(3-fluorophenyl)butanenitrile (PubChem CID 82137559) has the molecular formula C18H18FNO and a molecular weight of 283.35 g/mol. Its IUPAC name is 4-(2,4-dimethylphenoxy)-2-(3-fluorophenyl)butanenitrile.
| Compound Name | 4-(2,4-dimethylphenoxy)-2-(3-fluorophenyl)butanenitrile |
|---|---|
| PubChem CID | 82137559 |
| Molecular Formula | C18H18FNO |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 4-(2,4-dimethylphenoxy)-2-(3-fluorophenyl)butanenitrile |
| SMILES | Cc1ccc(OCCC(C#N)c2cccc(F)c2)c(C)c1 |
| InChI | InChI=1S/C18H18FNO/c1-13-6-7-18(14(2)10-13)21-9-8-16(12-20)15-4-3-5-17(19)11-15/h3-7,10-11,16H,8-9H2,1-2H3 |
| InChIKey | ZYBMJIKGOUJCAY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |