C18H18ClNO — CID 82137068
2-(4-chlorophenyl)-4-(2,5-dimethylphenoxy)butanenitrile (PubChem CID 82137068) has the molecular formula C18H18ClNO and a molecular weight of 299.80 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-(2,5-dimethylphenoxy)butanenitrile.
| Compound Name | 2-(4-chlorophenyl)-4-(2,5-dimethylphenoxy)butanenitrile |
|---|---|
| PubChem CID | 82137068 |
| Molecular Formula | C18H18ClNO |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-(4-chlorophenyl)-4-(2,5-dimethylphenoxy)butanenitrile |
| SMILES | Cc1ccc(C)c(OCCC(C#N)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H18ClNO/c1-13-3-4-14(2)18(11-13)21-10-9-16(12-20)15-5-7-17(19)8-6-15/h3-8,11,16H,9-10H2,1-2H3 |
| InChIKey | LOTWTSSTJUZDQU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |