C12H18N4O — CID 82143969
2-[2-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)ethoxy]ethanamine (PubChem CID 82143969) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-[2-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)ethoxy]ethanamine.
| Compound Name | 2-[2-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)ethoxy]ethanamine |
|---|---|
| PubChem CID | 82143969 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 2-[2-(2,6-dimethylimidazo[4,5-b]pyridin-3-yl)ethoxy]ethanamine |
| SMILES | Cc1cnc2c(c1)nc(C)n2CCOCCN |
| InChI | InChI=1S/C12H18N4O/c1-9-7-11-12(14-8-9)16(10(2)15-11)4-6-17-5-3-13/h7-8H,3-6,13H2,1-2H3 |
| InChIKey | ADTRUBNCQBFQEY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|