C14H12N2O3S — CID 82146644
2-(3-cyano-2-oxo-6-thiophen-2-yl-1-pyridinyl)butanoic acid (PubChem CID 82146644) has the molecular formula C14H12N2O3S and a molecular weight of 288.33 g/mol. Its IUPAC name is 2-(3-cyano-2-oxo-6-thiophen-2-yl-1-pyridinyl)butanoic acid.
| Compound Name | 2-(3-cyano-2-oxo-6-thiophen-2-yl-1-pyridinyl)butanoic acid |
|---|---|
| PubChem CID | 82146644 |
| Molecular Formula | C14H12N2O3S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-(3-cyano-2-oxo-6-thiophen-2-yl-1-pyridinyl)butanoic acid |
| SMILES | CCC(C(=O)O)n1c(-c2cccs2)ccc(C#N)c1=O |
| InChI | InChI=1S/C14H12N2O3S/c1-2-10(14(18)19)16-11(12-4-3-7-20-12)6-5-9(8-15)13(16)17/h3-7,10H,2H2,1H3,(H,18,19) |
| InChIKey | GUIGNUJAEPUXAC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |