C14H13N3OS2 — CID 82147595
3-(3-cyano-2-oxo-6-thiophen-2-yl-1-pyridinyl)-2-methylpropanethioamide (PubChem CID 82147595) has the molecular formula C14H13N3OS2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 3-(3-cyano-2-oxo-6-thiophen-2-yl-1-pyridinyl)-2-methylpropanethioamide.
| Compound Name | 3-(3-cyano-2-oxo-6-thiophen-2-yl-1-pyridinyl)-2-methylpropanethioamide |
|---|---|
| PubChem CID | 82147595 |
| Molecular Formula | C14H13N3OS2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 3-(3-cyano-2-oxo-6-thiophen-2-yl-1-pyridinyl)-2-methylpropanethioamide |
| SMILES | CC(Cn1c(-c2cccs2)ccc(C#N)c1=O)C(N)=S |
| InChI | InChI=1S/C14H13N3OS2/c1-9(13(16)19)8-17-11(12-3-2-6-20-12)5-4-10(7-15)14(17)18/h2-6,9H,8H2,1H3,(H2,16,19) |
| InChIKey | WHVXPODFOQKEIP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|