C16H8N2S2 — CID 3632903
2,5-dithiophen-2-ylbenzene-1,4-dicarbonitrile (PubChem CID 3632903) has the molecular formula C16H8N2S2 and a molecular weight of 292.39 g/mol. Its IUPAC name is 2,5-dithiophen-2-ylbenzene-1,4-dicarbonitrile.
| Compound Name | 2,5-dithiophen-2-ylbenzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 3632903 |
| Molecular Formula | C16H8N2S2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 2,5-dithiophen-2-ylbenzene-1,4-dicarbonitrile |
| SMILES | N#Cc1cc(-c2cccs2)c(C#N)cc1-c1cccs1 |
| InChI | InChI=1S/C16H8N2S2/c17-9-11-8-14(16-4-2-6-20-16)12(10-18)7-13(11)15-3-1-5-19-15/h1-8H |
| InChIKey | FMFFPNLZXNZQIF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |