C15H9N3OS — CID 142766488
1-methoxy-2-thiophen-2-ylindole-5,6-dicarbonitrile (PubChem CID 142766488) has the molecular formula C15H9N3OS and a molecular weight of 279.32 g/mol. Its IUPAC name is 1-methoxy-2-thiophen-2-ylindole-5,6-dicarbonitrile.
| Compound Name | 1-methoxy-2-thiophen-2-ylindole-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 142766488 |
| Molecular Formula | C15H9N3OS |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 1-methoxy-2-thiophen-2-ylindole-5,6-dicarbonitrile |
| SMILES | COn1c(-c2cccs2)cc2cc(C#N)c(C#N)cc21 |
| InChI | InChI=1S/C15H9N3OS/c1-19-18-13-7-12(9-17)11(8-16)5-10(13)6-14(18)15-3-2-4-20-15/h2-7H,1H3 |
| InChIKey | XGPFTQLTMZPXDM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 61.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |