C12H6N2S — CID 76539683
4-thiophen-2-ylbenzene-1,3-dicarbonitrile (PubChem CID 76539683) has the molecular formula C12H6N2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 4-thiophen-2-ylbenzene-1,3-dicarbonitrile.
| Compound Name | 4-thiophen-2-ylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 76539683 |
| Molecular Formula | C12H6N2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 4-thiophen-2-ylbenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1ccc(-c2cccs2)c(C#N)c1 |
| InChI | InChI=1S/C12H6N2S/c13-7-9-3-4-11(10(6-9)8-14)12-2-1-5-15-12/h1-6H |
| InChIKey | YUUKCOFDJVZARF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |