C18H11N3S — CID 69252500
4-[4-(3-aminothiophen-2-yl)phenyl]benzene-1,3-dicarbonitrile (PubChem CID 69252500) has the molecular formula C18H11N3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 4-[4-(3-aminothiophen-2-yl)phenyl]benzene-1,3-dicarbonitrile.
| Compound Name | 4-[4-(3-aminothiophen-2-yl)phenyl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 69252500 |
| Molecular Formula | C18H11N3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 4-[4-(3-aminothiophen-2-yl)phenyl]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1ccc(-c2ccc(-c3sccc3N)cc2)c(C#N)c1 |
| InChI | InChI=1S/C18H11N3S/c19-10-12-1-6-16(15(9-12)11-20)13-2-4-14(5-3-13)18-17(21)7-8-22-18/h1-9H,21H2 |
| InChIKey | WGGPBNDDCDEVHJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |