C21H12N4 — CID 163197792
4-amino-3,5-bis(4-cyanophenyl)benzonitrile (PubChem CID 163197792) has the molecular formula C21H12N4 and a molecular weight of 320.36 g/mol. Its IUPAC name is 4-amino-3,5-bis(4-cyanophenyl)benzonitrile.
| Compound Name | 4-amino-3,5-bis(4-cyanophenyl)benzonitrile |
|---|---|
| PubChem CID | 163197792 |
| Molecular Formula | C21H12N4 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 4-amino-3,5-bis(4-cyanophenyl)benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(C#N)cc(-c3ccc(C#N)cc3)c2N)cc1 |
| InChI | InChI=1S/C21H12N4/c22-11-14-1-5-17(6-2-14)19-9-16(13-24)10-20(21(19)25)18-7-3-15(12-23)4-8-18/h1-10H,25H2 |
| InChIKey | HBBNRTDTWJFEBU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|