C19H11N3OS — CID 69252497
2-[4-(2,4-dicyanophenyl)phenyl]thiophene-3-carboxamide (PubChem CID 69252497) has the molecular formula C19H11N3OS and a molecular weight of 329.38 g/mol. Its IUPAC name is 2-[4-(2,4-dicyanophenyl)phenyl]thiophene-3-carboxamide.
| Compound Name | 2-[4-(2,4-dicyanophenyl)phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 69252497 |
| Molecular Formula | C19H11N3OS |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 2-[4-(2,4-dicyanophenyl)phenyl]thiophene-3-carboxamide |
| SMILES | N#Cc1ccc(-c2ccc(-c3sccc3C(N)=O)cc2)c(C#N)c1 |
| InChI | InChI=1S/C19H11N3OS/c20-10-12-1-6-16(15(9-12)11-21)13-2-4-14(5-3-13)18-17(19(22)23)7-8-24-18/h1-9H,(H2,22,23) |
| InChIKey | KPKOUCDTDOETMZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 90.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |