C11H5N3O — CID 76539829
4-(1,3-oxazol-5-yl)benzene-1,3-dicarbonitrile (PubChem CID 76539829) has the molecular formula C11H5N3O and a molecular weight of 195.18 g/mol. Its IUPAC name is 4-(1,3-oxazol-5-yl)benzene-1,3-dicarbonitrile.
| Compound Name | 4-(1,3-oxazol-5-yl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 76539829 |
| Molecular Formula | C11H5N3O |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 4-(1,3-oxazol-5-yl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1ccc(-c2cnco2)c(C#N)c1 |
| InChI | InChI=1S/C11H5N3O/c12-4-8-1-2-10(9(3-8)5-13)11-6-14-7-15-11/h1-3,6-7H |
| InChIKey | PVHPCSAVWOZCKP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 73.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |