About [3-fluoro-4-(1,3-oxazol-5-yl)phenyl]hydrazine
[3-fluoro-4-(1,3-oxazol-5-yl)phenyl]hydrazine (PubChem CID 23106631) has the molecular formula C9H8FN3O
and a molecular weight of 193.18 g/mol. Its IUPAC name is [3-fluoro-4-(1,3-oxazol-5-yl)phenyl]hydrazine.
Molecular Properties
| Compound Name | [3-fluoro-4-(1,3-oxazol-5-yl)phenyl]hydrazine |
| PubChem CID | 23106631 |
| Molecular Formula | C9H8FN3O |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | [3-fluoro-4-(1,3-oxazol-5-yl)phenyl]hydrazine |
| SMILES | NNc1ccc(-c2cnco2)c(F)c1 |
| InChI | InChI=1S/C9H8FN3O/c10-8-3-6(13-11)1-2-7(8)9-4-12-5-14-9/h1-5,13H,11H2 |
| InChIKey | IMRUAAJPZRRFGJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-fluoro-4-(1,3-oxazol-5-yl)phenyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-4-(1,3-oxazol-5-yl)phenyl]hydrazine?
The IUPAC name of [3-fluoro-4-(1,3-oxazol-5-yl)phenyl]hydrazine (CID 23106631) is [3-fluoro-4-(1,3-oxazol-5-yl)phenyl]hydrazine.
What is the SMILES notation for [3-fluoro-4-(1,3-oxazol-5-yl)phenyl]hydrazine?
The canonical SMILES for [3-fluoro-4-(1,3-oxazol-5-yl)phenyl]hydrazine is NNc1ccc(-c2cnco2)c(F)c1.
What is the InChIKey of [3-fluoro-4-(1,3-oxazol-5-yl)phenyl]hydrazine?
The InChIKey is IMRUAAJPZRRFGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FN3O/c10-8-3-6(13-11)1-2-7(8)9-4-12-5-14-9/h1-5,13H,11H2.
What are the key properties of [3-fluoro-4-(1,3-oxazol-5-yl)phenyl]hydrazine?
[3-fluoro-4-(1,3-oxazol-5-yl)phenyl]hydrazine has a molecular weight of 193.18 g/mol, XLogP of 1.77, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-4-(1,3-oxazol-5-yl)phenyl]hydrazine is sourced from PubChem (CID 23106631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).