C9H8IN3O — CID 58767121
[2-iodo-4-(1,3-oxazol-5-yl)phenyl]hydrazine (PubChem CID 58767121) has the molecular formula C9H8IN3O and a molecular weight of 301.09 g/mol. Its IUPAC name is [2-iodo-4-(1,3-oxazol-5-yl)phenyl]hydrazine.
| Compound Name | [2-iodo-4-(1,3-oxazol-5-yl)phenyl]hydrazine |
|---|---|
| PubChem CID | 58767121 |
| Molecular Formula | C9H8IN3O |
| Molecular Weight | 301.09 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | [2-iodo-4-(1,3-oxazol-5-yl)phenyl]hydrazine |
| SMILES | NNc1ccc(-c2cnco2)cc1I |
| InChI | InChI=1S/C9H8IN3O/c10-7-3-6(1-2-8(7)13-11)9-4-12-5-14-9/h1-5,13H,11H2 |
| InChIKey | WPILPSWXPXSRSO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.09 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|