C12H11NO4 — CID 118720203
methyl 2-methoxy-5-(1,3-oxazol-5-yl)benzoate (PubChem CID 118720203) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is methyl 2-methoxy-5-(1,3-oxazol-5-yl)benzoate.
| Compound Name | methyl 2-methoxy-5-(1,3-oxazol-5-yl)benzoate |
|---|---|
| PubChem CID | 118720203 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | methyl 2-methoxy-5-(1,3-oxazol-5-yl)benzoate |
| SMILES | COC(=O)c1cc(-c2cnco2)ccc1OC |
| InChI | InChI=1S/C12H11NO4/c1-15-10-4-3-8(11-6-13-7-17-11)5-9(10)12(14)16-2/h3-7H,1-2H3 |
| InChIKey | ZRTNRWTTWGLRMX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |