C16H15N3O — CID 59004533
[4-[2-methyl-5-(1,3-oxazol-5-yl)phenyl]phenyl]hydrazine (PubChem CID 59004533) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is [4-[2-methyl-5-(1,3-oxazol-5-yl)phenyl]phenyl]hydrazine.
| Compound Name | [4-[2-methyl-5-(1,3-oxazol-5-yl)phenyl]phenyl]hydrazine |
|---|---|
| PubChem CID | 59004533 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | [4-[2-methyl-5-(1,3-oxazol-5-yl)phenyl]phenyl]hydrazine |
| SMILES | Cc1ccc(-c2cnco2)cc1-c1ccc(NN)cc1 |
| InChI | InChI=1S/C16H15N3O/c1-11-2-3-13(16-9-18-10-20-16)8-15(11)12-4-6-14(19-17)7-5-12/h2-10,19H,17H2,1H3 |
| InChIKey | BQVMZUBEJXHRNG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|