C23H19Cl2N3O2 — CID 89184689
N-[(1E,3Z)-1-amino-2,4-dichlorohexa-1,3,5-trien-3-yl]-4-[2-methyl-5-(1,3-oxazol-5-yl)phenyl]benzamide (PubChem CID 89184689) has the molecular formula C23H19Cl2N3O2 and a molecular weight of 440.33 g/mol. Its IUPAC name is N-[(1E,3Z)-1-amino-2,4-dichlorohexa-1,3,5-trien-3-yl]-4-[2-methyl-5-(1,3-oxazol-5-yl)phenyl]benzamide.
| Compound Name | N-[(1E,3Z)-1-amino-2,4-dichlorohexa-1,3,5-trien-3-yl]-4-[2-methyl-5-(1,3-oxazol-5-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 89184689 |
| Molecular Formula | C23H19Cl2N3O2 |
| Molecular Weight | 440.33 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N-[(1E,3Z)-1-amino-2,4-dichlorohexa-1,3,5-trien-3-yl]-4-[2-methyl-5-(1,3-oxazol-5-yl)phenyl]benzamide |
| SMILES | C=C/C(Cl)=C(NC(=O)c1ccc(-c2cc(-c3cnco3)ccc2C)cc1)\C(Cl)=C/N |
| InChI | InChI=1S/C23H19Cl2N3O2/c1-3-19(24)22(20(25)11-26)28-23(29)16-8-6-15(7-9-16)18-10-17(5-4-14(18)2)21-12-27-13-30-21/h3-13H,1,26H2,2H3,(H,28,29)/b20-11+,22-19- |
| InChIKey | UMCRWHQKVYUOPD-DXXWJJALSA-N |
| XLogP | 5.72 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.33 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|