C18H13ClN2O4 — CID 55835848
[2-(4-chloroanilino)-2-oxoethyl] 4-(1,3-oxazol-5-yl)benzoate (PubChem CID 55835848) has the molecular formula C18H13ClN2O4 and a molecular weight of 356.77 g/mol. Its IUPAC name is [2-(4-chloroanilino)-2-oxoethyl] 4-(1,3-oxazol-5-yl)benzoate.
| Compound Name | [2-(4-chloroanilino)-2-oxoethyl] 4-(1,3-oxazol-5-yl)benzoate |
|---|---|
| PubChem CID | 55835848 |
| Molecular Formula | C18H13ClN2O4 |
| Molecular Weight | 356.77 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | [2-(4-chloroanilino)-2-oxoethyl] 4-(1,3-oxazol-5-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(-c2cnco2)cc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H13ClN2O4/c19-14-5-7-15(8-6-14)21-17(22)10-24-18(23)13-3-1-12(2-4-13)16-9-20-11-25-16/h1-9,11H,10H2,(H,21,22) |
| InChIKey | SFDMUPHVGUGRFC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.77 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |