C17H15ClN2O — CID 104854359
N-[(4-chloro-2-methylphenyl)methyl]-4-(1,3-oxazol-5-yl)aniline (PubChem CID 104854359) has the molecular formula C17H15ClN2O and a molecular weight of 298.77 g/mol. Its IUPAC name is N-[(4-chloro-2-methylphenyl)methyl]-4-(1,3-oxazol-5-yl)aniline.
| Compound Name | N-[(4-chloro-2-methylphenyl)methyl]-4-(1,3-oxazol-5-yl)aniline |
|---|---|
| PubChem CID | 104854359 |
| Molecular Formula | C17H15ClN2O |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | N-[(4-chloro-2-methylphenyl)methyl]-4-(1,3-oxazol-5-yl)aniline |
| SMILES | Cc1cc(Cl)ccc1CNc1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C17H15ClN2O/c1-12-8-15(18)5-2-14(12)9-20-16-6-3-13(4-7-16)17-10-19-11-21-17/h2-8,10-11,20H,9H2,1H3 |
| InChIKey | BLMRQVBLFXHMFR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |