C16H16N2O2 — CID 62346531
N-[(5-ethylfuran-2-yl)methyl]-4-(1,3-oxazol-5-yl)aniline (PubChem CID 62346531) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-[(5-ethylfuran-2-yl)methyl]-4-(1,3-oxazol-5-yl)aniline.
| Compound Name | N-[(5-ethylfuran-2-yl)methyl]-4-(1,3-oxazol-5-yl)aniline |
|---|---|
| PubChem CID | 62346531 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-[(5-ethylfuran-2-yl)methyl]-4-(1,3-oxazol-5-yl)aniline |
| SMILES | CCc1ccc(CNc2ccc(-c3cnco3)cc2)o1 |
| InChI | InChI=1S/C16H16N2O2/c1-2-14-7-8-15(20-14)9-18-13-5-3-12(4-6-13)16-10-17-11-19-16/h3-8,10-11,18H,2,9H2,1H3 |
| InChIKey | BGWOIVAJUBETAH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 51.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |