C16H12Cl2N2O — CID 60942944
N-[(2,6-dichlorophenyl)methyl]-4-(1,3-oxazol-5-yl)aniline (PubChem CID 60942944) has the molecular formula C16H12Cl2N2O and a molecular weight of 319.19 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methyl]-4-(1,3-oxazol-5-yl)aniline.
| Compound Name | N-[(2,6-dichlorophenyl)methyl]-4-(1,3-oxazol-5-yl)aniline |
|---|---|
| PubChem CID | 60942944 |
| Molecular Formula | C16H12Cl2N2O |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methyl]-4-(1,3-oxazol-5-yl)aniline |
| SMILES | Clc1cccc(Cl)c1CNc1ccc(-c2cnco2)cc1 |
| InChI | InChI=1S/C16H12Cl2N2O/c17-14-2-1-3-15(18)13(14)8-20-12-6-4-11(5-7-12)16-9-19-10-21-16/h1-7,9-10,20H,8H2 |
| InChIKey | PIQLBVKLDZGZFV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |