C16H19N3O2 — CID 82148616
3-[4-(3,4-dimethylphenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]propanenitrile (PubChem CID 82148616) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-[4-(3,4-dimethylphenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]propanenitrile.
| Compound Name | 3-[4-(3,4-dimethylphenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 82148616 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-[4-(3,4-dimethylphenyl)-4-ethyl-2,5-dioxoimidazolidin-1-yl]propanenitrile |
| SMILES | CCC1(c2ccc(C)c(C)c2)NC(=O)N(CCC#N)C1=O |
| InChI | InChI=1S/C16H19N3O2/c1-4-16(13-7-6-11(2)12(3)10-13)14(20)19(9-5-8-17)15(21)18-16/h6-7,10H,4-5,9H2,1-3H3,(H,18,21) |
| InChIKey | DEWYZQPMINVCNO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|