C19H27N3O2 — CID 82148867
5-(2,4-dimethylphenyl)-5-ethyl-3-(piperidin-3-ylmethyl)imidazolidine-2,4-dione (PubChem CID 82148867) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 5-(2,4-dimethylphenyl)-5-ethyl-3-(piperidin-3-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | 5-(2,4-dimethylphenyl)-5-ethyl-3-(piperidin-3-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 82148867 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 5-(2,4-dimethylphenyl)-5-ethyl-3-(piperidin-3-ylmethyl)imidazolidine-2,4-dione |
| SMILES | CCC1(c2ccc(C)cc2C)NC(=O)N(CC2CCCNC2)C1=O |
| InChI | InChI=1S/C19H27N3O2/c1-4-19(16-8-7-13(2)10-14(16)3)17(23)22(18(24)21-19)12-15-6-5-9-20-11-15/h7-8,10,15,20H,4-6,9,11-12H2,1-3H3,(H,21,24) |
| InChIKey | NXRWKNYJTSAXHE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|