C20H25N3O — CID 82150383
3-[3-(2-ethyl-5,6-dimethylbenzimidazol-1-yl)propoxy]aniline (PubChem CID 82150383) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 3-[3-(2-ethyl-5,6-dimethylbenzimidazol-1-yl)propoxy]aniline.
| Compound Name | 3-[3-(2-ethyl-5,6-dimethylbenzimidazol-1-yl)propoxy]aniline |
|---|---|
| PubChem CID | 82150383 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 3-[3-(2-ethyl-5,6-dimethylbenzimidazol-1-yl)propoxy]aniline |
| SMILES | CCc1nc2cc(C)c(C)cc2n1CCCOc1cccc(N)c1 |
| InChI | InChI=1S/C20H25N3O/c1-4-20-22-18-11-14(2)15(3)12-19(18)23(20)9-6-10-24-17-8-5-7-16(21)13-17/h5,7-8,11-13H,4,6,9-10,21H2,1-3H3 |
| InChIKey | SXKRAEXJUSWUQL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|