C17H17F2N3O — CID 94757335
3-[2-(2-ethyl-5,6-difluorobenzimidazol-1-yl)ethoxy]aniline (PubChem CID 94757335) has the molecular formula C17H17F2N3O and a molecular weight of 317.34 g/mol. Its IUPAC name is 3-[2-(2-ethyl-5,6-difluorobenzimidazol-1-yl)ethoxy]aniline.
| Compound Name | 3-[2-(2-ethyl-5,6-difluorobenzimidazol-1-yl)ethoxy]aniline |
|---|---|
| PubChem CID | 94757335 |
| Molecular Formula | C17H17F2N3O |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 3-[2-(2-ethyl-5,6-difluorobenzimidazol-1-yl)ethoxy]aniline |
| SMILES | CCc1nc2cc(F)c(F)cc2n1CCOc1cccc(N)c1 |
| InChI | InChI=1S/C17H17F2N3O/c1-2-17-21-15-9-13(18)14(19)10-16(15)22(17)6-7-23-12-5-3-4-11(20)8-12/h3-5,8-10H,2,6-7,20H2,1H3 |
| InChIKey | GYRFAVIISLDKCE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|