C17H18N4OS — CID 82151301
2-[6-methyl-2-(2-phenoxyethyl)imidazo[4,5-b]pyridin-3-yl]ethanethioamide (PubChem CID 82151301) has the molecular formula C17H18N4OS and a molecular weight of 326.43 g/mol. Its IUPAC name is 2-[6-methyl-2-(2-phenoxyethyl)imidazo[4,5-b]pyridin-3-yl]ethanethioamide.
| Compound Name | 2-[6-methyl-2-(2-phenoxyethyl)imidazo[4,5-b]pyridin-3-yl]ethanethioamide |
|---|---|
| PubChem CID | 82151301 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[6-methyl-2-(2-phenoxyethyl)imidazo[4,5-b]pyridin-3-yl]ethanethioamide |
| SMILES | Cc1cnc2c(c1)nc(CCOc1ccccc1)n2CC(N)=S |
| InChI | InChI=1S/C17H18N4OS/c1-12-9-14-17(19-10-12)21(11-15(18)23)16(20-14)7-8-22-13-5-3-2-4-6-13/h2-6,9-10H,7-8,11H2,1H3,(H2,18,23) |
| InChIKey | PBLGFDLZZZCDCU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|