C15H16N4S2 — CID 94757870
3-[6-methyl-2-(thiophen-2-ylmethyl)imidazo[4,5-b]pyridin-3-yl]propanethioamide (PubChem CID 94757870) has the molecular formula C15H16N4S2 and a molecular weight of 316.46 g/mol. Its IUPAC name is 3-[6-methyl-2-(thiophen-2-ylmethyl)imidazo[4,5-b]pyridin-3-yl]propanethioamide.
| Compound Name | 3-[6-methyl-2-(thiophen-2-ylmethyl)imidazo[4,5-b]pyridin-3-yl]propanethioamide |
|---|---|
| PubChem CID | 94757870 |
| Molecular Formula | C15H16N4S2 |
| Molecular Weight | 316.46 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 3-[6-methyl-2-(thiophen-2-ylmethyl)imidazo[4,5-b]pyridin-3-yl]propanethioamide |
| SMILES | Cc1cnc2c(c1)nc(Cc1cccs1)n2CCC(N)=S |
| InChI | InChI=1S/C15H16N4S2/c1-10-7-12-15(17-9-10)19(5-4-13(16)20)14(18-12)8-11-3-2-6-21-11/h2-3,6-7,9H,4-5,8H2,1H3,(H2,16,20) |
| InChIKey | XRQUNGIQRIPHHW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|