C16H17N3S2 — CID 94756528
3-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)propanethioamide (PubChem CID 94756528) has the molecular formula C16H17N3S2 and a molecular weight of 315.47 g/mol. Its IUPAC name is 3-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)propanethioamide.
| Compound Name | 3-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)propanethioamide |
|---|---|
| PubChem CID | 94756528 |
| Molecular Formula | C16H17N3S2 |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 3-(5,6-dimethyl-2-thiophen-2-ylbenzimidazol-1-yl)propanethioamide |
| SMILES | Cc1cc2nc(-c3cccs3)n(CCC(N)=S)c2cc1C |
| InChI | InChI=1S/C16H17N3S2/c1-10-8-12-13(9-11(10)2)19(6-5-15(17)20)16(18-12)14-4-3-7-21-14/h3-4,7-9H,5-6H2,1-2H3,(H2,17,20) |
| InChIKey | LNOPAHSTDNBMNF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|