C16H18N4O — CID 82152127
2-methyl-4-[2-(6-methylimidazo[4,5-b]pyridin-3-yl)ethoxy]aniline (PubChem CID 82152127) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 2-methyl-4-[2-(6-methylimidazo[4,5-b]pyridin-3-yl)ethoxy]aniline.
| Compound Name | 2-methyl-4-[2-(6-methylimidazo[4,5-b]pyridin-3-yl)ethoxy]aniline |
|---|---|
| PubChem CID | 82152127 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-methyl-4-[2-(6-methylimidazo[4,5-b]pyridin-3-yl)ethoxy]aniline |
| SMILES | Cc1cnc2c(c1)ncn2CCOc1ccc(N)c(C)c1 |
| InChI | InChI=1S/C16H18N4O/c1-11-7-15-16(18-9-11)20(10-19-15)5-6-21-13-3-4-14(17)12(2)8-13/h3-4,7-10H,5-6,17H2,1-2H3 |
| InChIKey | LPHWVOXPPCBCOF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|