C18H17ClN2O2 — CID 82153862
(Z)-3-(3-amino-4-prop-2-enoxyphenyl)-N-(3-chlorophenyl)prop-2-enamide (PubChem CID 82153862) has the molecular formula C18H17ClN2O2 and a molecular weight of 328.80 g/mol. Its IUPAC name is (Z)-3-(3-amino-4-prop-2-enoxyphenyl)-N-(3-chlorophenyl)prop-2-enamide.
| Compound Name | (Z)-3-(3-amino-4-prop-2-enoxyphenyl)-N-(3-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 82153862 |
| Molecular Formula | C18H17ClN2O2 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | (Z)-3-(3-amino-4-prop-2-enoxyphenyl)-N-(3-chlorophenyl)prop-2-enamide |
| SMILES | C=CCOc1ccc(/C=C\C(=O)Nc2cccc(Cl)c2)cc1N |
| InChI | InChI=1S/C18H17ClN2O2/c1-2-10-23-17-8-6-13(11-16(17)20)7-9-18(22)21-15-5-3-4-14(19)12-15/h2-9,11-12H,1,10,20H2,(H,21,22)/b9-7- |
| InChIKey | CDDRJZLAZQXRQH-CLFYSBASSA-N |
| XLogP | 4.14 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|