C16H18FNO3S — CID 82154428
3-[2-[3-(4-fluorophenoxy)propyl]-4-methyl-1,3-thiazol-5-yl]propanoic acid (PubChem CID 82154428) has the molecular formula C16H18FNO3S and a molecular weight of 323.39 g/mol. Its IUPAC name is 3-[2-[3-(4-fluorophenoxy)propyl]-4-methyl-1,3-thiazol-5-yl]propanoic acid.
| Compound Name | 3-[2-[3-(4-fluorophenoxy)propyl]-4-methyl-1,3-thiazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 82154428 |
| Molecular Formula | C16H18FNO3S |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 3-[2-[3-(4-fluorophenoxy)propyl]-4-methyl-1,3-thiazol-5-yl]propanoic acid |
| SMILES | Cc1nc(CCCOc2ccc(F)cc2)sc1CCC(=O)O |
| InChI | InChI=1S/C16H18FNO3S/c1-11-14(8-9-16(19)20)22-15(18-11)3-2-10-21-13-6-4-12(17)5-7-13/h4-7H,2-3,8-10H2,1H3,(H,19,20) |
| InChIKey | LGPKPSTWDSDLTN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|