C16H22N2O3 — CID 82157901
6,6-dimethyl-8-(3-methylbutyl)-5H-[1,3]dioxolo[4,5-g]quinoxalin-7-one (PubChem CID 82157901) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 6,6-dimethyl-8-(3-methylbutyl)-5H-[1,3]dioxolo[4,5-g]quinoxalin-7-one.
| Compound Name | 6,6-dimethyl-8-(3-methylbutyl)-5H-[1,3]dioxolo[4,5-g]quinoxalin-7-one |
|---|---|
| PubChem CID | 82157901 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 6,6-dimethyl-8-(3-methylbutyl)-5H-[1,3]dioxolo[4,5-g]quinoxalin-7-one |
| SMILES | CC(C)CCN1C(=O)C(C)(C)Nc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C16H22N2O3/c1-10(2)5-6-18-12-8-14-13(20-9-21-14)7-11(12)17-16(3,4)15(18)19/h7-8,10,17H,5-6,9H2,1-4H3 |
| InChIKey | KGRGEJGNFVPAEO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|