C14H18Cl2N2O — CID 82157688
6,7-dichloro-3,3-dimethyl-1-(2-methylpropyl)-4H-quinoxalin-2-one (PubChem CID 82157688) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is 6,7-dichloro-3,3-dimethyl-1-(2-methylpropyl)-4H-quinoxalin-2-one.
| Compound Name | 6,7-dichloro-3,3-dimethyl-1-(2-methylpropyl)-4H-quinoxalin-2-one |
|---|---|
| PubChem CID | 82157688 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 6,7-dichloro-3,3-dimethyl-1-(2-methylpropyl)-4H-quinoxalin-2-one |
| SMILES | CC(C)CN1C(=O)C(C)(C)Nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C14H18Cl2N2O/c1-8(2)7-18-12-6-10(16)9(15)5-11(12)17-14(3,4)13(18)19/h5-6,8,17H,7H2,1-4H3 |
| InChIKey | AIIKYDZLZPCGFQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |