C13H15NO4 — CID 82159611
4,6-dimethoxy-N-methyl-3-oxo-1,2-dihydroindene-1-carboxamide (PubChem CID 82159611) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 4,6-dimethoxy-N-methyl-3-oxo-1,2-dihydroindene-1-carboxamide.
| Compound Name | 4,6-dimethoxy-N-methyl-3-oxo-1,2-dihydroindene-1-carboxamide |
|---|---|
| PubChem CID | 82159611 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 4,6-dimethoxy-N-methyl-3-oxo-1,2-dihydroindene-1-carboxamide |
| SMILES | CNC(=O)C1CC(=O)c2c(OC)cc(OC)cc21 |
| InChI | InChI=1S/C13H15NO4/c1-14-13(16)9-6-10(15)12-8(9)4-7(17-2)5-11(12)18-3/h4-5,9H,6H2,1-3H3,(H,14,16) |
| InChIKey | UPZISBRQVGKJOJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |