C9H8N2S2 — CID 82161852
4-methyl-5-pyridin-2-yl-3H-1,3-thiazole-2-thione (PubChem CID 82161852) has the molecular formula C9H8N2S2 and a molecular weight of 208.31 g/mol. Its IUPAC name is 4-methyl-5-pyridin-2-yl-3H-1,3-thiazole-2-thione.
| Compound Name | 4-methyl-5-pyridin-2-yl-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 82161852 |
| Molecular Formula | C9H8N2S2 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 4-methyl-5-pyridin-2-yl-3H-1,3-thiazole-2-thione |
| SMILES | Cc1[nH]c(=S)sc1-c1ccccn1 |
| InChI | InChI=1S/C9H8N2S2/c1-6-8(13-9(12)11-6)7-4-2-3-5-10-7/h2-5H,1H3,(H,11,12) |
| InChIKey | KYZRCKIGEWBCPJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|