C14H15N3O3S — CID 82166580
4-amino-N-pyridin-3-yl-3,4-dihydro-2H-chromene-6-sulfonamide (PubChem CID 82166580) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 4-amino-N-pyridin-3-yl-3,4-dihydro-2H-chromene-6-sulfonamide.
| Compound Name | 4-amino-N-pyridin-3-yl-3,4-dihydro-2H-chromene-6-sulfonamide |
|---|---|
| PubChem CID | 82166580 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4-amino-N-pyridin-3-yl-3,4-dihydro-2H-chromene-6-sulfonamide |
| SMILES | NC1CCOc2ccc(S(=O)(=O)Nc3cccnc3)cc21 |
| InChI | InChI=1S/C14H15N3O3S/c15-13-5-7-20-14-4-3-11(8-12(13)14)21(18,19)17-10-2-1-6-16-9-10/h1-4,6,8-9,13,17H,5,7,15H2 |
| InChIKey | HVBRMIBCMPQYOY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |