C15H18N4OS — CID 82166687
3-(5-tert-butyl-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)-4-methoxyaniline (PubChem CID 82166687) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 3-(5-tert-butyl-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)-4-methoxyaniline.
| Compound Name | 3-(5-tert-butyl-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)-4-methoxyaniline |
|---|---|
| PubChem CID | 82166687 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-(5-tert-butyl-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl)-4-methoxyaniline |
| SMILES | COc1ccc(N)cc1-c1nnc2scc(C(C)(C)C)n12 |
| InChI | InChI=1S/C15H18N4OS/c1-15(2,3)12-8-21-14-18-17-13(19(12)14)10-7-9(16)5-6-11(10)20-4/h5-8H,16H2,1-4H3 |
| InChIKey | PMVAFBMPQNRFHK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|