C16H22N4S — CID 82167368
5-(6-propan-2-yl-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-yl)pentan-1-amine (PubChem CID 82167368) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is 5-(6-propan-2-yl-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-yl)pentan-1-amine.
| Compound Name | 5-(6-propan-2-yl-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-yl)pentan-1-amine |
|---|---|
| PubChem CID | 82167368 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 5-(6-propan-2-yl-[1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-yl)pentan-1-amine |
| SMILES | CC(C)c1ccc2c(c1)sc1nnc(CCCCCN)n12 |
| InChI | InChI=1S/C16H22N4S/c1-11(2)12-7-8-13-14(10-12)21-16-19-18-15(20(13)16)6-4-3-5-9-17/h7-8,10-11H,3-6,9,17H2,1-2H3 |
| InChIKey | BRJIYHIAYPMKNS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|