C13H14N2S — CID 56724913
6-propan-2-yl-3-prop-2-ynyl-1,3-benzothiazol-2-imine (PubChem CID 56724913) has the molecular formula C13H14N2S and a molecular weight of 230.34 g/mol. Its IUPAC name is 6-propan-2-yl-3-prop-2-ynyl-1,3-benzothiazol-2-imine.
| Compound Name | 6-propan-2-yl-3-prop-2-ynyl-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 56724913 |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 6-propan-2-yl-3-prop-2-ynyl-1,3-benzothiazol-2-imine |
| SMILES | [H]/N=c1\sc2cc(C(C)C)ccc2n1CC#C |
| InChI | InChI=1S/C13H14N2S/c1-4-7-15-11-6-5-10(9(2)3)8-12(11)16-13(15)14/h1,5-6,8-9,14H,7H2,2-3H3/b14-13- |
| InChIKey | SUACCNYRLPZCIS-YPKPFQOOSA-N |
| XLogP | 2.94 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|