C18H28N4 — CID 82167764
1-[4-(1-ethylbenzimidazol-2-yl)piperidin-1-yl]-2-methylpropan-2-amine (PubChem CID 82167764) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-[4-(1-ethylbenzimidazol-2-yl)piperidin-1-yl]-2-methylpropan-2-amine.
| Compound Name | 1-[4-(1-ethylbenzimidazol-2-yl)piperidin-1-yl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 82167764 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | 1-[4-(1-ethylbenzimidazol-2-yl)piperidin-1-yl]-2-methylpropan-2-amine |
| SMILES | CCn1c(C2CCN(CC(C)(C)N)CC2)nc2ccccc21 |
| InChI | InChI=1S/C18H28N4/c1-4-22-16-8-6-5-7-15(16)20-17(22)14-9-11-21(12-10-14)13-18(2,3)19/h5-8,14H,4,9-13,19H2,1-3H3 |
| InChIKey | HVKARBOJIUHEGP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |