C16H22N2O — CID 82167955
1-(2-aminobutyl)-4,6,8-trimethylquinolin-2-one (PubChem CID 82167955) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-(2-aminobutyl)-4,6,8-trimethylquinolin-2-one.
| Compound Name | 1-(2-aminobutyl)-4,6,8-trimethylquinolin-2-one |
|---|---|
| PubChem CID | 82167955 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1-(2-aminobutyl)-4,6,8-trimethylquinolin-2-one |
| SMILES | CCC(N)Cn1c(=O)cc(C)c2cc(C)cc(C)c21 |
| InChI | InChI=1S/C16H22N2O/c1-5-13(17)9-18-15(19)8-11(3)14-7-10(2)6-12(4)16(14)18/h6-8,13H,5,9,17H2,1-4H3 |
| InChIKey | CMSBSIWKBFXKEJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |