C13H13N3O4S — CID 82169741
2-(benzenesulfonylmethyl)-6-(methylamino)pyrimidine-4-carboxylic acid (PubChem CID 82169741) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-6-(methylamino)pyrimidine-4-carboxylic acid.
| Compound Name | 2-(benzenesulfonylmethyl)-6-(methylamino)pyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 82169741 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-6-(methylamino)pyrimidine-4-carboxylic acid |
| SMILES | CNc1cc(C(=O)O)nc(CS(=O)(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C13H13N3O4S/c1-14-11-7-10(13(17)18)15-12(16-11)8-21(19,20)9-5-3-2-4-6-9/h2-7H,8H2,1H3,(H,17,18)(H,14,15,16) |
| InChIKey | GYKVAFYLQDDXPS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |