C7H9N3O2S — CID 83872051
6-(methylamino)-2-methylsulfanylpyrimidine-4-carboxylic acid (PubChem CID 83872051) has the molecular formula C7H9N3O2S and a molecular weight of 199.24 g/mol. Its IUPAC name is 6-(methylamino)-2-methylsulfanylpyrimidine-4-carboxylic acid.
| Compound Name | 6-(methylamino)-2-methylsulfanylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 83872051 |
| Molecular Formula | C7H9N3O2S |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 6-(methylamino)-2-methylsulfanylpyrimidine-4-carboxylic acid |
| SMILES | CNc1cc(C(=O)O)nc(SC)n1 |
| InChI | InChI=1S/C7H9N3O2S/c1-8-5-3-4(6(11)12)9-7(10-5)13-2/h3H,1-2H3,(H,11,12)(H,8,9,10) |
| InChIKey | NYBBDFKUIKCLPM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |