C8H14N4S — CID 83872054
N-methyl-6-(methylaminomethyl)-2-methylsulfanylpyrimidin-4-amine (PubChem CID 83872054) has the molecular formula C8H14N4S and a molecular weight of 198.29 g/mol. Its IUPAC name is N-methyl-6-(methylaminomethyl)-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | N-methyl-6-(methylaminomethyl)-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 83872054 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | N-methyl-6-(methylaminomethyl)-2-methylsulfanylpyrimidin-4-amine |
| SMILES | CNCc1cc(NC)nc(SC)n1 |
| InChI | InChI=1S/C8H14N4S/c1-9-5-6-4-7(10-2)12-8(11-6)13-3/h4,9H,5H2,1-3H3,(H,10,11,12) |
| InChIKey | AZGLWOATNJNWLG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |