C17H16FNO2 — CID 82172157
5-[(4-fluorophenyl)-hydroxymethyl]-1,3-dimethyl-3H-indol-2-one (PubChem CID 82172157) has the molecular formula C17H16FNO2 and a molecular weight of 285.32 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)-hydroxymethyl]-1,3-dimethyl-3H-indol-2-one.
| Compound Name | 5-[(4-fluorophenyl)-hydroxymethyl]-1,3-dimethyl-3H-indol-2-one |
|---|---|
| PubChem CID | 82172157 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 5-[(4-fluorophenyl)-hydroxymethyl]-1,3-dimethyl-3H-indol-2-one |
| SMILES | CC1C(=O)N(C)c2ccc(C(O)c3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C17H16FNO2/c1-10-14-9-12(5-8-15(14)19(2)17(10)21)16(20)11-3-6-13(18)7-4-11/h3-10,16,20H,1-2H3 |
| InChIKey | OFBPXLIQWKQQRF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |