C16H23NO2 — CID 82172354
5-(1-hydroxypentyl)-1,3,3-trimethylindol-2-one (PubChem CID 82172354) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 5-(1-hydroxypentyl)-1,3,3-trimethylindol-2-one.
| Compound Name | 5-(1-hydroxypentyl)-1,3,3-trimethylindol-2-one |
|---|---|
| PubChem CID | 82172354 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 5-(1-hydroxypentyl)-1,3,3-trimethylindol-2-one |
| SMILES | CCCCC(O)c1ccc2c(c1)C(C)(C)C(=O)N2C |
| InChI | InChI=1S/C16H23NO2/c1-5-6-7-14(18)11-8-9-13-12(10-11)16(2,3)15(19)17(13)4/h8-10,14,18H,5-7H2,1-4H3 |
| InChIKey | NOWCBMIKSJRASN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |